Search   
MSDS 
:

Eucerin anhydricum caffeine salve

CAS
:

SYNONYM :
TYPE OF TEST: TDLo - Lowest published toxic dose ROUTE OF EXPOSURE: Administration onto the skin SPECIES OBSERVED: Human - man DOSE / DURATION: 1430 mg/kg TOXIC EFFECTS: Behavioral - changes in motor activity (specific assay) Lungs, Thorax, or Respiration - respiratory stimulation Gastrointestinal - nausea or vomiting REFERENCE: DMWOAX Deutsche Medizinische Wochenschrift. (Stuttgart, Fed. Rep. Ger.) V.1-104, 1875-1979. Volume(issue)/page/year: 102,1851,1977
Search More   
CHEMICAL GROUP
NAMECASSYSNONYMS
Ethylene glycol, dimethanesulfonate4672-49-5
* 1,2-Bis(mesyloxy)ethane
* Ethane dimethane sulphonate
* Ethane 1,2-dimethanesulfonate
* 1,2-Ethanediol, bismethanesulfonate
* 1,2-Ethanediol, dimethanesulfonate
* 1,2-Ethanediyl dimethanesulfonate
* 1,2-Ethanediyl methanesulfonate
* Ethylene bis(methanesulfonate)
* Ethylene dimethanesulfonate
* Ethylene dimethanesulphonate
* Ethylene-1,2-dimethanesulphonate
* Ethylene glycol dimesylate
* Methanesulfonic acid, ethylene ester1,2-Ethanediol dimethanesulfonate
4672-49-5
DMSE
Dimethylene dimethanesulfonate
EDS
Ethylene glycol dimethanesulfonate
Ethylene glycol, dimethanesulfonate
Ethylene methanesulfonate
NC 429
NSC 10716
NSC17016
1,2-Ethanediol, dimethanesulfonate (9CI)
4-04-00-00019 (Beilstein Handbook Reference)
AI3-61167
BRN 1787642
Ethane dimethanesulphonate
Ethylene-1,2-dimethanesulfonate
NSC 17016
C002994
ethane 1,2-dimethanesulfonate
ethane dimethane sulfonate
ethane dimethanesulfonate
ethane dimethyl sulfonate
ethanediol 1,2-dimethanesulfonate
Ethylamine, 2-(1,1-diphenylethoxy)-N,N-dimethyl-3572-74-5
* N,N-Dimethyl-2-(alpha-methyl-alpha-phenylbenzyloxy)ethylamine
* 2-(1,1-Diphenylethoxy)-N,N-dimethylethylamine
* Ethylamine, N,N-dimethyl-2-(1,1-diphenylethoxy)-
* Ethylamine, N,N-dimethyl-2-((alpha-methyl-alpha-phenylbenzyl)oxy)-
* Mephenhydramine
* Moxastin
* Substanz NR. 19343572-74-5
4-06-00-04714 (Beilstein Handbook Reference)
Alfadryl
BRN 1981628
EINECS 222-688-3
Ethylamine, 2-(1,1-diphenylethoxy)-N,N-dimethyl-
Mephenhydraminum
Moxastina
Moxastina [INN-Spanish]
Moxastine
Moxastinum
Moxastinum [INN-Latin]
Spofa 325
Substanz NR. 1934 [German]
Theadrylettae
Therdryl
UNII-ZSJ254W6SF
Ethylene glycol, dinitrate628-96-6
* Dinitroglicol
* Dinitroglycol
* EGDN
* Ethanediol dinitrate
* Ethylene dinitrate
* Ethylene glycol dinitrate
* Ethylene nitrate
* Ethylenglykoldinitrat
* Glycoldinitraat
* Glycol dinitrate
* Glycol (dinitrate de)
* Glykoldinitrat
* Nitroglycol
* Nitroglykol1,2-Ethanediol, dinitrate
628-96-6
ethane-1,2-diyl dinitrate
Ethylene glycol, ester with silicic acid (417622-94-5
* Ethylene glycol silicate
* Silicic acid, tetrakis(2-hydroxyethyl) ester
* Silistren
* Tetraglycol silicate
* Tetrakis(beta-hydroxyethyl) silicate
* Tetrakis(2-hydroxyethyl) silicate17622-94-5
2-01-00-00523 (Beilstein Handbook Reference)
BRN 1710025
EINECS 241-598-5
Ethylene glycol, ester with silicic acid (4:1)
Silicic acid (H4SiO4), tetrakis(2-hydroxyethyl) ester
Silicic acid, tetrakis(2-hydroxyethyl) ester (9CI)
Tetra(ethylene glycol) silicate
Tetrakis(2-hydroxyethyl) orthosilicate
Ethylene glycol, monoacetate542-59-6
* Acetic acid 2-hydroxyethyl ester
* 1,2-Ethanediol, monoacetate
* Glycol monoacetate
* Glycol-monoacetin
* 2-Hydroxyethyl acetate
* 2-Hydroxyethylester kyseliny octove1,2-Ethanediol, 1-acetate
2-Acetoxyethanol
2-Hydroxyethylester kyseliny octove [Czech]
4-02-00-00214 (Beilstein Handbook Reference)
542-59-6
AI3-15367
BRN 1743114
EINECS 208-821-8
Ethylene glycol acetate
Ethylene glycol monoacetate
Ethylene glycol, monoacetate
Ethylenediol, monoacetate
NSC 9234
beta-Hydroxyethyl acetate
Ethylene glycol, monoethanesulfonate
* 1,2-Ethanediol, monoethanesulfonate
* Hydroxyethyl ethanesulfonate
Ethylene glycol, monoisopropylsulfonate
* 1,2-Ethanediol, isopropylsulfonate
* Hydroxyethyl isopropylsulfonate
Ethylene glycol, monomethanesulfonate19690-37-0
* 1,2-Ethanediol, monomethanesulfonate
* Hydroxyethyl methanesulfonate
* beta-Hydroxyethyl methanesulfonate
* 2-Hydroxyethyl methanesulfonate.beta.-Hydroxyethyl methanesulfonate
19690-37-0
Ethylene glycol, monomethanesulfonate
NSC64950
1,2-Ethanediol, monomethanesulfonate (9CI)
BRN 3080997
Ethane methanesulfonate
NSC 64950
Ethylene isocyanide, bis(p-hydroxybenzylidene)-580-74-5
* Brevicid
* Brevicide
* Brevicide-X
* 1,4-Di-p-oxyphenyl-2,3-di-isonitrilo-1,3-butadien
* Ophthocillin
* Phenol, 4,4'-(2,3-diisocyano-1,3-butadiene-1,4-diyl)bis-
* Trianthil
* Xanthocillin
* Xantyrid1,4-Di-p-oxyphenyl-2,3-di-isonitrilo-1,3-butadiene
4-13-00-02885 (Beilstein Handbook Reference)
580-74-5
BRN 3700094
Ethylene isocyanide, bis(p-hydroxybenzylidene)-
NSC 179485
NSC 227183
Phenol, 4,4'-(2,3-diisocyano-1,3-butadiene-1,4-diyl)bis- (9CI)
UNII-EX637I77PC
Xanthocillin (x)
Xanthocillin X
Xanthocillinum
Xantocilina
Xantocilina [INN-Spanish]
Xantocillin
Xantocilline
Xantocilline [INN-French]
Xantocillinum
Xantocillinum [INN-Latin]
NSC179485
WLN: QR D1UYNU1&YNU1&U1R DQ
NSC227183
XANTHOCILLIN
Ethylene isocyanide, bis(p-methoxybenzylidene)-4464-33-9
* Benzene, 1,1'-(2,3-diisocyano-1,3-butadiene-1,4-diyl)bis(4-methoxy-
* Bis(p-methoxybenzylidene)ethylene isocyanide
* Xanthocillin X dimethyl ether
* Xanthocillin X permethyl ether4464-33-9
Benzene, 1,1'-(2,3-diisocyano-1,3-butadiene-1,4-diyl)bis(4-methoxy- (9CI)
Ethylene isocyanide, bis(p-methoxybenzylidene)-
Ethylene isocyanide,
(p-hydroxybenzylidene)(p-methoxybenzylidine)-
19559-24-1
* Phenol, 4-(2,3-diisocyano-4-(4-methoxyphenyl)-1,3-butadienyl)-
* Xanthocillin X monomethyl ether19559-24-1
BRN 4332417
Ethylene isocyanide, (p-hydroxybenzylidene)(p-methoxybenzylidine)-
Phenol, 4-(2,3-diisocyano-4-(4-methoxyphenyl)-1,3-butadienyl)- (9CI)
Ethylene oxide75-21-8
* Aethylenoxid
* Amprolene
* Anprolene
* Anproline
* Dihydrooxirene
* Dimethylene oxide
* ENT-26263
* E.O.
* 1,2-Epoxyaethan
* Epoxyethane
* 1,2-Epoxyethane
* Ethene oxide
* Ethox
* Ethyleenoxide
* Ethylene oxide
* Ethylene (oxyde d')
* Etilene (ossido di)
* ETO
* Etylenu tlenek
* FEMA No. 2433
* Merpol
* NCI-C50088
* Oxacyclopropane
* Oxane
* Oxidoethane
* alpha,beta-Oxidoethane
* Oxiraan
* Oxiran
* Oxirane
* Oxirene, dihydro-
* Oxyfume
* Oxyfume 12
* RCRA waste number U115
* Sterilizing gas ethylene oxide 100%
* T-Gas75-21-8
ETHYLENE OXIDE
D005027
Ethylene Oxide
Oxide, Ethylene
D03474
oxirane
Ethylamine, N,N-dimethyl-2-phenyl-1-(o-tolyl)-,
hydrochloride

* N,N-Dimethyl-2-phenyl-1-(o-tolyl)ethylamine hydrochloride
Ethylamine, 1,2-diphenyl-, hydrochloride, (-)-14149-01-0
* (-)-1,2-Diphenylethylamine hydrochloride14149-01-0
Ethylamine, 1,2-diphenyl-, hydrochloride, (-)-
Ethylene oxide, mixed with carbon dioxide8070-50-6
* Anhydride carbonique et oxyde d'ethylene melanges
* Oxyfume 20
* Oxyfume 308070-50-6
Anhydride carbonique et oxyde d'ethylene melanges [French]
Ethylene oxide, mixed with carbon dioxide
Oxirane, mixt. with carbon dioxide
Ethylene, polymers, pyrolyzate9002-88-4
* Polyethylene (pyrolysis)9002-88-4
D020959
Ethene, homopolymer
HDPE
High Density Polyethylene
High-Density Polyethylene
LDPE
Low Density Polyethylene
Low-Density Polyethylene
Polyethylene, High-Density
Polyethylene, Low-Density
Polythene
Polyethylene as
Polyethylene as med Mol. Wt.
Ethylene propylene rubber61789-00-2
* Rubber, ethylene-propene61789-00-2
Ethylene propylene rubber
Ethylene sulfide420-12-2
* Aethylensulfid
* 2,3-Dihydrothiirene
* Ethylene episulfide
* Ethylene episulphide
* Ethylene sulphide
* Thiacyclopropane
* Thiirane
* Thiirene, 2,3-dihydro-Ethylene sulfide
NSC 89690
420-12-2
AI3-52351
Aethylensulfid [German]
CCRIS 782
EINECS 206-993-9
Epithioethane
HSDB 5489
Sulfurane
NSC89690
WLN: T3STJ
InChI=1/C2H4S/c1-2-3-1/h1-2H
ethylene sulfide
thiirane
Ethylene, tetrachloro-127-18-4
* Ankilostin
* Antisol 1
* Carbon bichloride
* Carbon dichloride
* Czterochloroetylen
* Didakene
* Dilatin PT
* Dow-per
* ENT 1,860
* Ethene, tetrachloro-
* Ethylene tetrachloride
* Fedal-UN
* NCI-C04580
* PER
* Perawin
* Perchloorethyleen, per
* Perchlor
* Perchloraethylen, per
* Perchlorethylene
* Perchloroethylene
* Perclene
* Perclene D
* Percloroetilene
* Percosolve
* PERK
* Perklone
* Persec
* RCRA waste number U210
* Tetlen
* Tetracap
* Tetrachlooretheen
* Tetrachloraethen
* Tetrachlorethylene
* Tetrachloroethene
* Tetrachloroethylene
* 1,1,2,2-Tetrachloroethylene
* Tetrachloroethylene
* Tetracloroetene
* Tetraleno
* Tetralex
* Tetravec
* Tetroguer
* Tetropil127-18-4
Antisal 1
Ethylene, tetrachloro-
Fedal-Un
NSC9777
Nema
Nema, veterinary
PERC
PerSec
Perchlorethylene, per
Tetraguer
WLN: GYGUYGG
1,1,2,2-Tetrachloroethene
4-01-00-00715 (Beilstein Handbook Reference)
AI3-01860
BRN 1361721
CCRIS 579
Caswell No. 827
Czterochloroetylen [Polish]
EINECS 204-825-9
EPA Pesticide Chemical Code 078501
Ethene, 1,1,2,2-tetrachloro-
HSDB 124
NSC 9777
PCE
Perchloorethyleen, per [Dutch]
Perchloraethylen, per [German]
Perchlorethylene, per [French]
Percloroetilene [Italian]
RCRA waste no. U210
Tetrachlooretheen [Dutch]
Tetrachloraethen [German]
Tetrachloroethylene (IUPAC)
Tetrachloroethylene [UN1897] [Poison]
Tetracloroetene [Italian]
UN 1897
UNII-TJ904HH8SN
InChI=1/C2Cl4/c3-1(4)2(5)
ethene, tetrachloro-
tetrachloroethylene
NCGC00090944-02
NCGC00090944-01
D013750
TCE
tetrachloroethene
1,1,2,2-tetrachloroethylene
TETRACHLOROETHENE
TETRACHLOROETHYLENE
Ethylene, tetrafluoro-116-14-3
* Perfluoroethene
* Perfluoroethylene
* Tetrafluorethylene
* Tetrafluoroethene
* Tetrafluoroethylene
* 1,1,2,2-Tetrafluoroethylene
* TFE116-14-3
9014-83-9
CCRIS 7738
EINECS 204-126-9
Ethene, 1,1,2,2-tetrafluoro-
Ethene, tetrafluoro-
Ethylene, tetrafluoro-
Fluoroplast 4
HSDB 844
Tetrafluoroethene (9CI)
Tetrafluoroethylene monomer
Tetrafluoroethylene, inhibited [UN1081] [Flammable gas]
C015531
tetrafluoroethene
tetrafluoroethylene
tetrafluoroethylene, ion(1+)
tetrafluoroethylene, ion(1-)
Ethylene, tetrafluoro-, polymer9002-84-0
* Aflon
* Algloflon
* Algoflon SV
* Alkathene rxdg33
* AMIP 15M
* Balfon 7000
* BDH 29-801
* Chromosorb T
* Dixon 164
* DLX-6000
* Duroid 5870
* EK 1108GY-A
* Ethene, tetrafluoro-, homopolymer
* Ethicon PtFe
* F 103
* FBF 74D
* F 4K20
* Fluo-Kem
* Fluon
* Fluon CD 1
* Fluon CD 023
* Fluon CD 042
* Fluon G4
* Fluon G163
* Fluon G201
* Fluon GPI
* Fluon L 169
* Fluon L 170
* Fluon L 171
* Fluon L 169B
* Fluoroflex
* Fluorolon 4
* Fluoropak 80
* Fluoroplast 4
* Fluoroplast 4B
* Fluoroplast 4D
* Fluoroplast 4M
* Fluoropore FP 120
* F 4MB
* FN 3
* FT-4
* Ftorlon 4
* Ftorlon F-4MB
* Ftorlon 4M
* Ftoroplast 4
* Ftoroplast 4B
* Ftoroplast 4D
* Ftoroplast F-4
* Ftoroplast FBF 74D
* Ftoroplast F 4MB
* Ftoroplast 4K20
* Ftoroplast 4M
* F 4Zh20
* G 163
* Gore-tex
* Halon G 80
* Halon G 183
* Halon G 700
* Halon TFEG 180
* Heydeflon
* Hostaflon TF
* Hostaflon TF 2026
* Hostaflon TF 2053
* L 169
* Molykote 522
* Polifen
* Politef
* Poly(ethylene tetrafluoride)
* Polyfene
* Polyflon
* Polyflon D1
* Polyflon EK 4108GY
* Polyflon EK 1108GY-A
* Polyflon F 103
* Polyflon M12
* Polyflon M21
* Polyflon M12A
* Polytef
* Polytetrafluoroethene
* Polytetrafluoroethylene
* Soreflon 604
* Soreflon 5A
* T 8A
* Tarflen
* T 5B
* TE 30
* Teflon
* Teflon 5
* Teflon 6
* Teflon 30
* Teflon 110
* Teflon 6C
* Teflon K
* Teflon T5
* Teflon T 6
* Teflon T 30
* Teflon TFE
* Tetrafluoroethene homopolymer
* Tetrafluoroethene polymer
* Tetrafluoroethylene homopolymer
* Tetrafluoroethylene polymers
* Tetran 30
* Tetran PtFe
* TL 102
* TL-R
* TL-V
* Unon P
* Valflon
* Velflon
* Zitex H 662-124
* Zitex K 223-122PTFE
Ethylene, tetrafluoro-, polymers, combustion products
* Polytetrafluoroethylene deposition products
* Tetrafluoroethylene polymers combustion products
Ethylene, tetraiodo-513-92-8
* Diodoform
* Ethene, tetraiodo-
* Tetraiodoethylene513-92-8
Diiodoform
Ethylene periodide
Ethylene tetraiodide
Ethylene, tetraiodo-
NSC66408
Periodoethene
4-01-00-00724 (Beilstein Handbook Reference)
BRN 1741414
Caswell No. 842
EINECS 208-176-2
EPA Pesticide Chemical Code 046908
Ethene, 1,1,2,2-tetraiodo-
NSC 66408
Tetraiodoethene
Ethylene, tribromo-598-16-3
* Ethene, tribromo-
* Tribromoethene
* Tribromoethylene
* 1,1,2-Tribromoethylene4-01-00-00722 (Beilstein Handbook Reference)
598-16-3
BRN 1736791
EINECS 209-920-9
Ethene, 1,1,2-tribromo-
Ethylene tribromide
Ethylene, tribromo-
Ethylene, tribromo- (VAN) (8CI)
NSC 343621
NSC343621
Ethylamine, 1,2-diphenyl-, hydrochloride, (+)-14149-00-9
* (+)-1,2-Diphenylethylamine hydrochloride14149-00-9
Ethylamine, 1,2-diphenyl-, hydrochloride, (+)-
Ethylene, trichloro-79-01-6
* Acetylene trichloride
* Algylen
* Anamenth
* Benzinol
* Blacosolv
* Blancosolv
* Cecolene
* Chlorilen
* 1-Chloro-2,2-dichloroethylene
* Chlorylen
* Circosolv
* Crawhaspol
* Densinfluat
* 1,1-Dichloro-2-chloroethylene
* Dow-tri
* Dukeron
* Ethinyl trichloride
* Ethylene trichloride
* Fleck-flip
* Flock FLIP
* Fluate
* Germalgene
* Lanadin
* Lethurin
* Narcogen
* Narkosoid
* NCI-C04546
* Nialk
* Perm-A-chlor
* Petzinol
* Philex
* RCRA waste number U228
* Threthylen
* Threthylene
* Trethylene
* Tri
* Triad
* Trial
* Triasol
* Trichlooretheen
* Trichloorethyleen, tri
* Trichloraethen
* Trichloraethylen, tri
* Trichloran
* Trichloren
* Trichlorethylene, tri
* Trichloroethene
* Trichloroethylene
* 1,1,2-Trichloroethylene
* 1,2,2-Trichloroethylene
* Trichloroethylene
* Tri-clene
* Tricloretene
* Tricloroetilene
* Trielene
* Trielin
* Trielina
* Trieline
* Trilen
* Trilene
* Trilene TE-141
* Triline
* Trimar
* Triol
* Tri-plus
* Tri-plus M
* Vestrol
* Vitran
* Westrosol79-01-6
NCGC00091202-01
D014241
Ethene, trichloro-
Ethinyl Trichloride
Trichloride, Ethinyl
1,1,2-trichloroethene
TCE
TRICHLOROETHYLENE
Trichloroethylene (without epichlorohydrin)
Ethylene, tetrakis(p-methoxyphenyl)- (8CI)10019-24-6
* Benzene, 1,1',1'',1'''-(1,2-ethenediylidene)tetrakis(4-methoxy-
* Tetra-anisylethylene
* Tetrakis(p-methoxyphenyl)ethylene
* 1,1,2,2-Tetrakis(p-methoxyphenyl)ethene
* Tetrakis(4-methoxyphenyl)ethylene10019-24-6
Benzene, 1,1',1'',1'''-(1,2-ethenediylidene)tetrakis(4-methoxy- (9CI)
Ethylene, tetrakis(p-methoxyphenyl)- (8CI)
NSC 132124
Tetra-p-anisylethylene
1-Methoxy-4-(1,2,2-tris(4-methoxyphenyl)vinyl)benzene
AIDS-126917
AIDS126917
Benzene, {1,1',1'',1'''-(1,2-ethenediylidene)tetrakis[4-methoxy-}
NSC132124
Benzene, 1,1',1'',1'''-(1,2-ethenediylidene)tetrakis[4-methoxy-
Ethylene, triphenyl-58-72-0
* Benzene, 1,1',1''-(1-ethenyl-2-ylidene)tris-
* Benzilidenediphenylmethane
* Triphenylethene
* Triphenylethylene
* 1,1,2-Triphenylethylene1,2,2-Triphenylethylene
58-72-0
Ethylene, triphenyl-
NSC17535
EINECS 200-395-1
NSC 17535
C14134
C037749
triphenylethylene
TRIPHENYLETHYLENE
1,1',1''-ethene-1,1,2-triyltribenzene
Ethylenimine151-56-4
* Aethylenimin
* Azacyclopropane
* Aziran
* Aziridin
* Aziridine
* 1H-Azirine, dihydro-
* Dihydroazirene
* Dihydro-1H-azirine
* Dimethyleneimine
* EI
* ENT-50324
* Ethyleenimine
* Ethyleneimine
* Ethyleneimine
* Etilenimina
* RCRA waste number P054
* TL 337151-56-4
5-20-01-00003 (Beilstein Handbook Reference)
99932-76-0
AI3-50324
Aethylenimin [German]
Aziridin [German]
BRN 0102380
CCRIS 296
Dihydroazirine
EINECS 205-793-9
Ethyleenimine [Dutch]
Ethylene imine
Ethyleneimine, inhibited [UN1185] [Poison]
Ethylenimine
Etilenimina [Italian]
HSDB 540
RCRA waste no. P054
C033132
aziridine
aziridine, conjugate acid
ethylenimine
AZIRIDINE
aminoethylene
azacyclopropane
azirane
dimethylenimine
ethylene-imine
Ethylenimine, N-chloro-10165-13-6
* Aziridine, N-chloro-
* Aziridinyl chloride
* N-Chloroaziridine10165-13-6
5-20-01-00090 (Beilstein Handbook Reference)
BRN 0102401
Ethylenimine, N-chloro-
N-Chloroethylenimine
Ethylenimonium, ethyl(2-chloroethyl)-,
picrylsulfonate
63918-55-8
* Ethyl-beta-chloroethyl-ethylenimonium picrylsulfonate
* 1-Ethyl-1-(beta-chloroethyl)ethylenimonium picrylsulfonate63918-55-8
Ethylenimonium, ethyl(2-chloroethyl)-, picrylsulfonate
Ethylenimonium, methyl(2-chloroethyl)-,
picrylsulfonate
547-95-5
* Aziridinium, 1-(2-chloroethyl)-1-methyl-, 2,4,6-trinitrobenzenesulfonate
* Chlorimine picryl sulfonate
* 1-(2-Chloroethyl)-1-methylaziridinium 2,4,6-trinitrobenzenesulfonate
* Methyl-beta-chloroethyl-ethylenimonium picrylsulfonate
* 1-Methyl-1-(beta-chloroethyl)ethylenimonium picrylsulfonate547-95-5
Ethylenimonium, methyl(2-chloroethyl)-, picrylsulfonate
Ethylenimonium, methyl(2-hydroxyethyl)-,
picrylsulfonate
63918-39-8
* Methyl-beta-hydroxyethyl-ethylenimonium picrylsulfonate
* 1-Methyl-1-(beta-hydroxyethyl)ethylenimonium picrylsulfonate63918-39-8
Ethylenimonium, methyl(2-hydroxyethyl)-, picrylsulfonate
Ethyl oxyhydrate8030-89-5
* Pyroligneous acids, reaction products with et alc., distillates
* Rum ether
* ZV8-253
Ethyl sulfide352-93-2
* Diethylsulfid
* Diethylthioether
* Ethane, 1,1'-thiobis-
* Ethyl monosulfide
* Ethylthioethane
* Ethyl thioether
* Sulfodor
* 3-Thiapentane
* Thioethyl ether1,1'-Thiobisethane
352-93-2
Diethyl sulfide
Ethyl sulfide
NSC75157
WLN: 2S2
1,1-Thiobisethane
AI3-18785
Diethyl sulfide [UN2375] [Flammable liquid]
Diethyl sulphide
Diethylsulfid [Czech]
EINECS 206-526-9
HSDB 5563
NSC 75157
Sulfodor [Czech]
1,1'-thiodiethane
InChI=1/C4H10S/c1-3-5-4-2/h3-4H2,1-2H
ethane, 1,1'-thiobis-
ZINC01529401
Ethylamine, 1,2-diphenyl-, hydrochloride, (+-)-
* (+-)-1,2-Diphenylethylamine hydrochloride
Ethyl sulfoxide70-29-1
* Diaethylsulfoxid
* Diethyl sulfoxide
* Diethyl sulphoxide
* Ethane, 1,1'-sulfinylbis-
* 1,1'-Sulfinylbis(ethane)70-29-1
Diaethylsulfoxid [German]
Diethylsulfoxide
EINECS 200-732-2
Ethane, 1,1'-sulfinylbis- (9CI)
Ethyl sulfoxide
NSC 139125
NSC139125
WLN: OS2&2
InChI=1/C4H10OS/c1-3-6(5)4-2/h3-4H2,1-2H
1-((Ethylthio)methyl)-1,4-dimethylpiperazinium
di-p-toluenesulfonate, polymer
73118-13-51-((Ethylthio)methyl)-1,4-dimethylpiperazinium di-p-toluenesulfonate, polymer
73118-13-5
Piperazinium, 1-((ethylthio)methyl)-1,4-dimethyl-, salt with 4-methylbenzenesulfonic acid (1:1), homopolymer
ETM (polymer)71966-09-1
* ETM71966-09-1
ETM (polymer)
E toxin
Etoxon EPA9004-82-4Polyoxy-1,2-ethanediyl-alpha-sulfo-omega-dodecyloxy-sodium salt
AES
9004-82-4
Poly(oxy-1,2-ethanediyl), .alpha.-sulfo-.omega.-(dodecyloxy)-, sodium salt
Eucadine
Eucalyptus alba Reinw. ex. Blume, extract excluding
roots
Eucalyptus cloeziana F. Muell., extract excluding
roots
Eucalpytus globulus Labill., extract
Eucalyptus oil8000-48-4
* Dinkum oil
* Eucalyptus citriodora oil
* Eukalyptus oel
* Oil of eucalyptus1,3,3-Trimethyl-2-oxabicyclo[2.2.2.]-octane
8000-48-4
8055-93-4
Caswell No. 618A
EPA Pesticide Chemical Code 040503
Essential eucalyptus oil
Essential oils, eucalyptus
Eucalyptus absolute (Eucalyptus globulus Labille)
Eucalyptus citriodora distillate
Eucalyptus citriodora oil (Eucalyptus citriodora)
Eucalyptus concrete (Eucalyptus globulus Lab.)
Eucalyptus globulus distillate
Eucalyptus globulus oil
Eucalyptus oil
Eucalyptus oil (Eucalyptus globulus Labille)
Eucalyptus oil citriodora
Eucalyptus terpene oil
Eukalyptus oel [German]
FEMA No. 2466
Globulus
Ingalipt
Oil eucalyptus globulus or macarthuri
Oils, essential, eucalyptus
Oils, eucalyptus
Red gum
UNII-2R04ONI662
D05327
Eucalyptus oil (JP15)
Ethylamine, 2-(diphenylmethoxy)-N,N-dimethyl-58-73-1
* Amidryl
* Antistominum
* Automin
* Bagodryl
* Baramine
* Benachlor
* Benapon
* Benodin
* Benodine
* Benzhydramine
* Benzhydraminum
* Benzhydroamina
* N-(Benzhydryloksy-etylo)dwumetyloamina
* 2-(Benzhydryloxy)-N,N-dimethylethylamine
* Betramin
* Dabylen
* Debendrin
* Dermistina
* Dermodrin
* Desentol
* Diabenyl
* Diabylen
* Dibondrin
* Difedryl
* Difenhydramin
* Difenidramina
* Dimedrol base
* beta-Dimethylamino-aethyl-benzhydryl-aether
* beta-Dimethylaminoethanol diphenylmethyl ether
* alpha-(2-Dimethylaminoethoxy)diphenylmethane
* beta-Dimethylaminoethylbenzhydryl ether
* Diphenhydramine
* 2-(Diphenylmethoxy)-N,N-dimethylethylamine
* Dylamon
* Etanautine
* Ethanamine, 2-(diphenylmethoxy)-N,N-dimethyl-
* Ethylamine, N,N-dimethyl-2-(diphenylmethoxy)-
* Histaxin
* Hyadrine
* Ibiodral
* Medidryl
* Mephadryl
* Nausen
* Novamina
* PM 255
* Probedryl
* S51N,N-Dimethyl-4,4-diphenyl-3-oxabutylamine
147-24-0 (hydrochloride)
4-10-00-00125 (Beilstein Handbook Reference)
58-73-1
88637-37-0 (citrate (1:1))
Alledryl
Allergical
Antomin
BRN 1914136
Benadrin
Benylan
Benzantine
Benzhydril
CCRIS 1959
Difenhidramina
Difenhidramina [INN-Spanish]
Difenidramina [Italian]
Dihidral
Diphantine
Diphenhydraminum
Diphenhydraminum [INN-Latin]
Drylistan
EINECS 200-396-7
Ethylamine, 2-(diphenylmethoxy)-N,N-dimethyl-
FAR 90X2
HSDB 3066
N-(2-(Diphenylmethoxy)ethyl)-N,N-dimethylamine
N-(Benzhydryloksy-etylo)dwumetyloamina [Polish]
O-Benzhydryldimethylaminoethanol
Rigidyl
Syntedril
UNII-8GTS82S83M
beta-Dimethylamino-aethyl-benzhydryl-aether [German]
beta-Dimethylaminoethylbenzhydrylether
147-24-0 (HYDROCHLORIDE)
2-(Benzhydryloxy)-N,N-dimethylethylamine, hydrochloride
AIDS-018608
AIDS018608
Benadryl (hydrochloride)
D00300
Diphenhydramine (JP15/INN)
Restamin
Restamin (TN)
2-Diphenylmethoxy-N,N-dimethylethylamine
Allerdryl
Benhydramin
Benylin
Citrate, Diphenhydramine
D004155
Diphenhydramine Citrate
Diphenhydramine Citrate (1:1)
Diphenhydramine Hydrochloride
Diphenylhydramin
Diphenylhydramine
Hydrochloride, Diphenhydramine
2-[(diphenylmethyl)oxy]-N,N-dimethylethanamine
Eucerin anhydricum caffeine salve
Eucommia ulmoides Oliv., extract
Eudesma-3,11(13)-dien-12-oic acid28399-17-9
* 12-Carboxyeudesma-3,11(13)-diene28399-17-9
BRN 4184260
Eudesma-3,11(13)-dien-12-oic acid

Free MSDS Search ( Providing 250,000+ Material Properties )
Chemcas.com